Products 1879030-01-9
CAS 1879030-01-9 appears in our catalog under these names: 4'-Hydroxy-6,7,8,3'-tetramethoxyflavonol, 4'-Hydroxy-6,7,8,3'-tetramethoxyflavonol, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 25mg, 10mg, 50mg, 10 mg, 5 mg, 1 mg, 5mg.
3-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7,8-trimethoxychromen-4-one (CAS 1879030-01-9) is a chemical compound with the molecular formula C19H18O8 and a molecular weight of 374.3 g/mol. IUPAC name: 3-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7,8-trimethoxychromen-4-one. InChIKey: WZBSKSHQKMJJHQ-UHFFFAOYSA-N.
| Molecular formula | C19H18O8 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 3-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7,8-trimethoxychromen-4-one |
| InChIKey | WZBSKSHQKMJJHQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=C(C(=O)C3=CC(=C(C(=C3O2)OC)OC)OC)O)O |
Computed by PubChem (NCBI)