CAS 187999-13-9 is the registry number for 5-(4-Chlorophenyl)-1,3,4-oxadiazole-2-carboxylic Acid. Offered by: TRC. Available pack sizes: 750mg.
5-(4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylic acid (CAS 187999-13-9) is a chemical compound with the molecular formula C9H5ClN2O3 and a molecular weight of 224.60 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylic acid. InChIKey: ASSVYHKYJOKDQY-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O3 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylic acid |
| InChIKey | ASSVYHKYJOKDQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)C(=O)O)Cl |
Computed by PubChem (NCBI)