CAS 2065250-61-3 is the registry number for 3-Chloro-6-hydroxy-[1,5]naphthyridine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-chloro-6-oxo-5H-1,5-naphthyridine-4-carboxylic acid (CAS 2065250-61-3) is a chemical compound with the molecular formula C9H5ClN2O3 and a molecular weight of 224.60 g/mol. IUPAC name: 3-chloro-6-oxo-5H-1,5-naphthyridine-4-carboxylic acid. InChIKey: IGRGCHAVRREDRX-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O3 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 3-chloro-6-oxo-5H-1,5-naphthyridine-4-carboxylic acid |
| InChIKey | IGRGCHAVRREDRX-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C(C(=CN=C21)Cl)C(=O)O |
Computed by PubChem (NCBI)