Products 65095-35-4

CAS 65095-35-4 is the registry number for 6-Chloro-4-oxo-3,4-dihydrophthalazine-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-chloro-4-oxo-3H-phthalazine-1-carboxylic acid (CAS 65095-35-4) is a chemical compound with the molecular formula C9H5ClN2O3 and a molecular weight of 224.60 g/mol. IUPAC name: 6-chloro-4-oxo-3H-phthalazine-1-carboxylic acid. InChIKey: CJLKDNJCPXSCOP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClN2O3
Molecular weight224.60 g/mol
IUPAC name6-chloro-4-oxo-3H-phthalazine-1-carboxylic acid
InChIKeyCJLKDNJCPXSCOP-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Cl)C(=O)NN=C2C(=O)O

Computed by PubChem (NCBI)