CAS 65095-35-4 is the registry number for 6-Chloro-4-oxo-3,4-dihydrophthalazine-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-oxo-3H-phthalazine-1-carboxylic acid (CAS 65095-35-4) is a chemical compound with the molecular formula C9H5ClN2O3 and a molecular weight of 224.60 g/mol. IUPAC name: 6-chloro-4-oxo-3H-phthalazine-1-carboxylic acid. InChIKey: CJLKDNJCPXSCOP-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O3 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 6-chloro-4-oxo-3H-phthalazine-1-carboxylic acid |
| InChIKey | CJLKDNJCPXSCOP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)NN=C2C(=O)O |
Computed by PubChem (NCBI)