Products 2644018-30-2
CAS 2644018-30-2 is the registry number for 7-Chloro-5-nitro-2,3-dihydrobenzofuran-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-5-nitro-2,3-dihydro-1-benzofuran-4-carbonitrile (CAS 2644018-30-2) is a chemical compound with the molecular formula C9H5ClN2O3 and a molecular weight of 224.60 g/mol. IUPAC name: 7-chloro-5-nitro-2,3-dihydro-1-benzofuran-4-carbonitrile. InChIKey: VNPHGYSOWRTWHQ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O3 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 7-chloro-5-nitro-2,3-dihydro-1-benzofuran-4-carbonitrile |
| InChIKey | VNPHGYSOWRTWHQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C(=C21)C#N)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)