Products 2832066-08-5

CAS 2832066-08-5 is the registry number for 5-Chloro-2-oxo-1,2-dihydro-1,6-naphthyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-chloro-2-oxo-1H-1,6-naphthyridine-3-carboxylic acid (CAS 2832066-08-5) is a chemical compound with the molecular formula C9H5ClN2O3 and a molecular weight of 224.60 g/mol. IUPAC name: 5-chloro-2-oxo-1H-1,6-naphthyridine-3-carboxylic acid. InChIKey: FGLGEEUGBIQABZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClN2O3
Molecular weight224.60 g/mol
IUPAC name5-chloro-2-oxo-1H-1,6-naphthyridine-3-carboxylic acid
InChIKeyFGLGEEUGBIQABZ-UHFFFAOYSA-N
SMILESC1=CN=C(C2=C1NC(=O)C(=C2)C(=O)O)Cl

Computed by PubChem (NCBI)