Products 1881291-83-3
CAS 1881291-83-3 is the registry number for 4-butoxy-2,3-dichlorophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-butoxy-2,3-dichlorophenol (CAS 1881291-83-3) is a chemical compound with the molecular formula C10H12Cl2O2 and a molecular weight of 235.10 g/mol. IUPAC name: 4-butoxy-2,3-dichlorophenol. InChIKey: LJDTYEJJZPOLDQ-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2O2 |
|---|---|
| Molecular weight | 235.10 g/mol |
| IUPAC name | 4-butoxy-2,3-dichlorophenol |
| InChIKey | LJDTYEJJZPOLDQ-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C(=C(C=C1)O)Cl)Cl |
Computed by PubChem (NCBI)