CAS 1881288-78-3 is the registry number for 1,5-dichloro-2,3-diethoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,5-dichloro-2,3-diethoxybenzene (CAS 1881288-78-3) is a chemical compound with the molecular formula C10H12Cl2O2 and a molecular weight of 235.10 g/mol. IUPAC name: 1,5-dichloro-2,3-diethoxybenzene. InChIKey: GSQWJFBQRRNYOU-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2O2 |
|---|---|
| Molecular weight | 235.10 g/mol |
| IUPAC name | 1,5-dichloro-2,3-diethoxybenzene |
| InChIKey | GSQWJFBQRRNYOU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)Cl)Cl)OCC |
Computed by PubChem (NCBI)