CAS 1379163-23-1 appears in our catalog under these names: 1,3-bis(chloromethyl)-2,5-dimethoxybenzene, 95%, 2,6-Bis(chloromethyl)-1,4-dimethoxybenzene, >98.0%(GC), 2,6-Bis(chloromethyl)-1,4-dimethoxybenzene, 98.0%, 98.0%, 2,6-BIS(CHLOROMETHYL)-1,4-DIMETHOXYBENZENE, 95%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
1,3-bis(chloromethyl)-2,5-dimethoxybenzene (CAS 1379163-23-1) is a chemical compound with the molecular formula C10H12Cl2O2 and a molecular weight of 235.10 g/mol. IUPAC name: 1,3-bis(chloromethyl)-2,5-dimethoxybenzene. InChIKey: YMYUSUWLRACOTR-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2O2 |
|---|---|
| Molecular weight | 235.10 g/mol |
| IUPAC name | 1,3-bis(chloromethyl)-2,5-dimethoxybenzene |
| InChIKey | YMYUSUWLRACOTR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)CCl)OC)CCl |
Computed by PubChem (NCBI)