Products 1881329-40-3
CAS 1881329-40-3 is the registry number for 2,3-dichloro-4-(2-methylpropoxy)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,3-dichloro-4-(2-methylpropoxy)phenol (CAS 1881329-40-3) is a chemical compound with the molecular formula C10H12Cl2O2 and a molecular weight of 235.10 g/mol. IUPAC name: 2,3-dichloro-4-(2-methylpropoxy)phenol. InChIKey: CARVPSOGTGPKAB-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2O2 |
|---|---|
| Molecular weight | 235.10 g/mol |
| IUPAC name | 2,3-dichloro-4-(2-methylpropoxy)phenol |
| InChIKey | CARVPSOGTGPKAB-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C(=C(C=C1)O)Cl)Cl |
Computed by PubChem (NCBI)