CAS 1134-52-7 is the registry number for 1,2-Bis(chloromethyl)-4,5-Dimethoxybenzene. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-bis(chloromethyl)-4,5-dimethoxybenzene (CAS 1134-52-7) is a chemical compound with the molecular formula C10H12Cl2O2 and a molecular weight of 235.10 g/mol. IUPAC name: 1,2-bis(chloromethyl)-4,5-dimethoxybenzene. InChIKey: HBOBUTXJMIXYPE-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2O2 |
|---|---|
| Molecular weight | 235.10 g/mol |
| IUPAC name | 1,2-bis(chloromethyl)-4,5-dimethoxybenzene |
| InChIKey | HBOBUTXJMIXYPE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CCl)CCl)OC |
Computed by PubChem (NCBI)