Products 1820735-79-2

CAS 1820735-79-2 is the registry number for 1,2-Dichloro-3-(3-methoxypropoxy)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

1,2-dichloro-3-(3-methoxypropoxy)benzene (CAS 1820735-79-2) is a chemical compound with the molecular formula C10H12Cl2O2 and a molecular weight of 235.10 g/mol. IUPAC name: 1,2-dichloro-3-(3-methoxypropoxy)benzene. InChIKey: IHXYHFCGRUXPDS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12Cl2O2
Molecular weight235.10 g/mol
IUPAC name1,2-dichloro-3-(3-methoxypropoxy)benzene
InChIKeyIHXYHFCGRUXPDS-UHFFFAOYSA-N
SMILESCOCCCOC1=C(C(=CC=C1)Cl)Cl

Computed by PubChem (NCBI)