CAS 1881322-30-0 is the registry number for 3-nitroquinoline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-nitroquinoline;hydrochloride (CAS 1881322-30-0) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 3-nitroquinoline;hydrochloride. InChIKey: RKJLTIHXRGEAKK-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 3-nitroquinoline;hydrochloride |
| InChIKey | RKJLTIHXRGEAKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)