Products 912839-50-0

CAS 912839-50-0 is the registry number for Methyl 4-amino-3-ethoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-amino-3-ethoxybenzoate;hydrochloride (CAS 912839-50-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 4-amino-3-ethoxybenzoate;hydrochloride. InChIKey: DRCIOHKUCIIIOW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO3
Molecular weight231.67 g/mol
IUPAC namemethyl 4-amino-3-ethoxybenzoate;hydrochloride
InChIKeyDRCIOHKUCIIIOW-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1)C(=O)OC)N.Cl

Computed by PubChem (NCBI)