Products 2241594-38-5
CAS 2241594-38-5 appears in our catalog under these names: (S)-7-Chlorochroman-4-amine hydrochloride, 95%, (S)–7–CHLOROCHROMAN–4–AMINE HCL, (S)-7-CHLOROCHROMAN-4-AMINE HCL, 98%, 98%, (S)-7-CHLOROCHROMAN-4-AMINE HCL, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(4S)-7-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 2241594-38-5) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: (4S)-7-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: MUKIHNNHMAAWPC-QRPNPIFTSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | (4S)-7-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | MUKIHNNHMAAWPC-QRPNPIFTSA-N |
| SMILES | C1COC2=C([C@H]1N)C=CC(=C2)Cl.Cl |
Computed by PubChem (NCBI)