Products 1251302-02-9
CAS 1251302-02-9 appears in our catalog under these names: 3-Amino-3-(3,5-dichlorophenyl)propan-1-ol, 95%, 3-Amino-3-(3,5-dichlorophenyl)propan-1-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
3-amino-3-(3,5-dichlorophenyl)propan-1-ol (CAS 1251302-02-9) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 3-amino-3-(3,5-dichlorophenyl)propan-1-ol. InChIKey: GDDRJIHKCNSDRF-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 3-amino-3-(3,5-dichlorophenyl)propan-1-ol |
| InChIKey | GDDRJIHKCNSDRF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(CCO)N |
Computed by PubChem (NCBI)