CAS 188349-22-6 is the registry number for BRN3OMe. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4S,6R)-4-azido-2-(hydroxymethyl)-6-methoxyoxan-3-ol (CAS 188349-22-6) is a chemical compound with the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. IUPAC name: (2R,3S,4S,6R)-4-azido-2-(hydroxymethyl)-6-methoxyoxan-3-ol. InChIKey: FLZWXHAJKPSXOG-WNJXEPBRSA-N.
| Molecular formula | C7H13N3O4 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | (2R,3S,4S,6R)-4-azido-2-(hydroxymethyl)-6-methoxyoxan-3-ol |
| InChIKey | FLZWXHAJKPSXOG-WNJXEPBRSA-N |
| SMILES | CO[C@H]1C[C@@H]([C@@H]([C@H](O1)CO)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)