Products 1883508-36-8
CAS 1883508-36-8 is the registry number for 2-[3-(carboxymethyl)bicyclo[1.1.1]pentan-1-yl]acetic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-[3-(carboxymethyl)-1-bicyclo[1.1.1]pentanyl]acetic acid (CAS 1883508-36-8) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: 2-[3-(carboxymethyl)-1-bicyclo[1.1.1]pentanyl]acetic acid. InChIKey: NIFVNAPZCUAOOT-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-[3-(carboxymethyl)-1-bicyclo[1.1.1]pentanyl]acetic acid |
| InChIKey | NIFVNAPZCUAOOT-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)