Products 188397-05-9

CAS 188397-05-9 is the registry number for 6-Acetyl-N-caboxylate Melatonin Ethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.

Structural formula: {0} (CAS {1})

Ethyl 3-(2-acetamidoethyl)-6-acetyl-5-methoxyindole-1-carboxylate (CAS 188397-05-9) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: ethyl 3-(2-acetamidoethyl)-6-acetyl-5-methoxyindole-1-carboxylate. InChIKey: LDCAAXMIAGUBJA-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22N2O5
Molecular weight346.4 g/mol
IUPAC nameethyl 3-(2-acetamidoethyl)-6-acetyl-5-methoxyindole-1-carboxylate
InChIKeyLDCAAXMIAGUBJA-UHFFFAOYSA-N
SMILESCCOC(=O)N1C=C(C2=CC(=C(C=C21)C(=O)C)OC)CCNC(=O)C

Computed by PubChem (NCBI)