Products 881376-42-7
CAS 881376-42-7 appears in our catalog under these names: Pinoxaden Metabolite SYN502836, 4’Desmethyl-4’Carboxylate Pinoxaden Despivoloyl, Pinoxaden M6 SYN 502836, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Sigma-Aldrich, HPC Standards. Available pack sizes: on request, 100mg, 10MG, 1x1ml.
4-(7,9-dioxo-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepin-8-yl)-3,5-diethylbenzoic acid (CAS 881376-42-7) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: 4-(7,9-dioxo-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepin-8-yl)-3,5-diethylbenzoic acid. InChIKey: PZURTZWDEUDQOT-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 4-(7,9-dioxo-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepin-8-yl)-3,5-diethylbenzoic acid |
| InChIKey | PZURTZWDEUDQOT-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC(=C1C2C(=O)N3CCOCCN3C2=O)CC)C(=O)O |
Computed by PubChem (NCBI)