Products 93590-37-5

CAS 93590-37-5 is the registry number for Phenobarbital 1-Diethyl Butyrate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

Ethyl 4-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)butanoate (CAS 93590-37-5) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: ethyl 4-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)butanoate. InChIKey: OKBSKWNTWHTPPO-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22N2O5
Molecular weight346.4 g/mol
IUPAC nameethyl 4-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)butanoate
InChIKeyOKBSKWNTWHTPPO-UHFFFAOYSA-N
SMILESCCC1(C(=O)NC(=O)N(C1=O)CCCC(=O)OCC)C2=CC=CC=C2

Computed by PubChem (NCBI)