CAS 1884303-05-2 appears in our catalog under these names: 1-tert-Butyl 3-methyl 3-hydroxyazetidine-1,3-dicarboxylate, 95%, 1-tert-Butyl 3-methyl 3-hydroxyazetidine-1,3-dicarboxylate, 97%, Methyl 1-boc-3-hydroxyazetidine-3-carboxylate, 1-tert-Butyl 3-methyl 3-hydroxyazetidine-1,3-dicarboxylate 95%, 1-tert-butyl 3-methyl 3-hydroxyazetidine-1,3-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 5g, 10g, 0,5g, 2g, 100mg, 500mg.
1-O-tert-butyl 3-O-methyl 3-hydroxyazetidine-1,3-dicarboxylate (CAS 1884303-05-2) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-hydroxyazetidine-1,3-dicarboxylate. InChIKey: WSGWPDZGNJTWIB-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-hydroxyazetidine-1,3-dicarboxylate |
| InChIKey | WSGWPDZGNJTWIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(=O)OC)O |
Computed by PubChem (NCBI)