Products 1884712-55-3
CAS 1884712-55-3 appears in our catalog under these names: (R)-6-Bromo-4-methyl-4,5-dihydro-1h-benzo[b][1,4]diazepin-2(3h)-one, 95%, (R)-6-Bromo-4-methyl-4,5-dihydro-1H-benzo[b][1,4]diazepin-2(3H)-one, 95%+, 95%+. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(4R)-6-bromo-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (CAS 1884712-55-3) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: (4R)-6-bromo-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one. InChIKey: PKBGRARKNVLDTQ-ZCFIWIBFSA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | (4R)-6-bromo-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| InChIKey | PKBGRARKNVLDTQ-ZCFIWIBFSA-N |
| SMILES | C[C@@H]1CC(=O)NC2=C(N1)C(=CC=C2)Br |
Computed by PubChem (NCBI)