CAS 1884712-72-4 is the registry number for (S)-6-Bromo-4-methyl-1,3,4,5-tetrahydro-2H-benzo[b][1,4]diazepin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-6-bromo-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (CAS 1884712-72-4) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: (4S)-6-bromo-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one. InChIKey: PKBGRARKNVLDTQ-LURJTMIESA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | (4S)-6-bromo-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| InChIKey | PKBGRARKNVLDTQ-LURJTMIESA-N |
| SMILES | C[C@H]1CC(=O)NC2=C(N1)C(=CC=C2)Br |
Computed by PubChem (NCBI)