CAS 188476-28-0 appears in our catalog under these names: (R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-hydroxy-2-methylpropanoate, 98%, 98%, Boc-2-Me-D-Ser-OMe, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
Methyl (2R)-3-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 188476-28-0) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: methyl (2R)-3-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: OUUNEDPIBZNRMT-SNVBAGLBSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | methyl (2R)-3-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | OUUNEDPIBZNRMT-SNVBAGLBSA-N |
| SMILES | C[C@@](CO)(C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)