Products 188526-18-3

CAS 188526-18-3 is the registry number for Benzyl 2-hydroxy-3-oxohexanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl 2-hydroxy-3-oxohexanoate (CAS 188526-18-3) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: benzyl 2-hydroxy-3-oxohexanoate. InChIKey: NEOCMCMYUZOFHC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O4
Molecular weight236.26 g/mol
IUPAC namebenzyl 2-hydroxy-3-oxohexanoate
InChIKeyNEOCMCMYUZOFHC-UHFFFAOYSA-N
SMILESCCCC(=O)C(C(=O)OCC1=CC=CC=C1)O

Computed by PubChem (NCBI)