Products 18867-45-3

CAS 18867-45-3 is the registry number for Nebivolol Impurity 44. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(1R,2R)-2-(dimethylamino)-1-(4-nitrophenyl)propane-1,3-diol (CAS 18867-45-3) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: (1R,2R)-2-(dimethylamino)-1-(4-nitrophenyl)propane-1,3-diol. InChIKey: WKFXOUSFZMOKOH-GHMZBOCLSA-N.

Identity
Molecular formulaC11H16N2O4
Molecular weight240.26 g/mol
IUPAC name(1R,2R)-2-(dimethylamino)-1-(4-nitrophenyl)propane-1,3-diol
InChIKeyWKFXOUSFZMOKOH-GHMZBOCLSA-N
SMILESCN(C)[C@H](CO)[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])O

Computed by PubChem (NCBI)