CAS 18867-45-3 is the registry number for Nebivolol Impurity 44. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(1R,2R)-2-(dimethylamino)-1-(4-nitrophenyl)propane-1,3-diol (CAS 18867-45-3) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: (1R,2R)-2-(dimethylamino)-1-(4-nitrophenyl)propane-1,3-diol. InChIKey: WKFXOUSFZMOKOH-GHMZBOCLSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | (1R,2R)-2-(dimethylamino)-1-(4-nitrophenyl)propane-1,3-diol |
| InChIKey | WKFXOUSFZMOKOH-GHMZBOCLSA-N |
| SMILES | CN(C)[C@H](CO)[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)