CAS 188713-12-4 is the registry number for (5E)-5-(1H-indol-3-ylmethylidene)-1,3-thiazolidine-2,4-dione. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-3H-1,3-thiazol-2-one (CAS 188713-12-4) is a chemical compound with the molecular formula C12H8N2O2S and a molecular weight of 244.27 g/mol. IUPAC name: 4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-3H-1,3-thiazol-2-one. InChIKey: HNYJSNHOKJLPCW-FNORWQNLSA-N.
| Molecular formula | C12H8N2O2S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-3H-1,3-thiazol-2-one |
| InChIKey | HNYJSNHOKJLPCW-FNORWQNLSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C/C3=C(NC(=O)S3)O)/C=N2 |
Computed by PubChem (NCBI)