CAS 188847-00-9 appears in our catalog under these names: Pyrrolidine-1,3-dicarboxylic acid 1-benzyl ester 3-methyl ester, 1-Benzyl 3-methyl pyrrolidine-1,3-dicarboxylate, 98%, 98%, 1-Benzyl 3-methyl pyrrolidine-1,3-dicarboxylate, 97%, 1-Benzyl 3-methyl pyrrolidine-1,3-dicarboxylate, 98%. Offered by: Triz Pharma-Tech, Chemat, Fluorochem, Ambeed. Available pack sizes: on request, 250mg, 1g, 5g, 25g, 10g.
1-O-benzyl 3-O-methyl pyrrolidine-1,3-dicarboxylate (CAS 188847-00-9) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl pyrrolidine-1,3-dicarboxylate. InChIKey: JZDIVDBVWXFEMR-UHFFFAOYSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 1-O-benzyl 3-O-methyl pyrrolidine-1,3-dicarboxylate |
| InChIKey | JZDIVDBVWXFEMR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)