Products 1888661-71-9

CAS 1888661-71-9 is the registry number for 2-((tert-Butoxycarbonyl)amino)-4-cyclobutylbutanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-cyclobutyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1888661-71-9) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 4-cyclobutyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: OTCAYPVLVXQJGB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H23NO4
Molecular weight257.33 g/mol
IUPAC name4-cyclobutyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
InChIKeyOTCAYPVLVXQJGB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CCC1CCC1)C(=O)O

Computed by PubChem (NCBI)