Products 189032-15-3
CAS 189032-15-3 is the registry number for 2-Amino-5-(3-trifluoromethyl-3H-diazirin-3-yl)-phenol. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-5-[3-(trifluoromethyl)diazirin-3-yl]phenol (CAS 189032-15-3) is a chemical compound with the molecular formula C8H6F3N3O and a molecular weight of 217.15 g/mol. IUPAC name: 2-amino-5-[3-(trifluoromethyl)diazirin-3-yl]phenol. InChIKey: ZNIRULZVXWFPOE-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3O |
|---|---|
| Molecular weight | 217.15 g/mol |
| IUPAC name | 2-amino-5-[3-(trifluoromethyl)diazirin-3-yl]phenol |
| InChIKey | ZNIRULZVXWFPOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2(N=N2)C(F)(F)F)O)N |
Computed by PubChem (NCBI)