CAS 923130-33-0 appears in our catalog under these names: 7-Methyl-2-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyridin-5(1h)-one, 95%, 7-Methyl-2-(trifluoromethyl)-(1,2,4)triazolo(1,5-a)pyridin-5(3h)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
7-methyl-2-(trifluoromethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one (CAS 923130-33-0) is a chemical compound with the molecular formula C8H6F3N3O and a molecular weight of 217.15 g/mol. IUPAC name: 7-methyl-2-(trifluoromethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one. InChIKey: DSCVNBORKMEUBZ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3O |
|---|---|
| Molecular weight | 217.15 g/mol |
| IUPAC name | 7-methyl-2-(trifluoromethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one |
| InChIKey | DSCVNBORKMEUBZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=C1)N=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)