CAS 2891602-15-4 is the registry number for 6-(trifluoromethoxy)-1H-indazol-7-amine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-(trifluoromethoxy)-1H-indazol-7-amine (CAS 2891602-15-4) is a chemical compound with the molecular formula C8H6F3N3O and a molecular weight of 217.15 g/mol. IUPAC name: 6-(trifluoromethoxy)-1H-indazol-7-amine. InChIKey: HAYGVZDUOXTYCC-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3O |
|---|---|
| Molecular weight | 217.15 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-1H-indazol-7-amine |
| InChIKey | HAYGVZDUOXTYCC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=NN2)N)OC(F)(F)F |
Computed by PubChem (NCBI)