CAS 675843-98-8 is the registry number for 2-Methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-5-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (CAS 675843-98-8) is a chemical compound with the molecular formula C8H6F3N3O and a molecular weight of 217.15 g/mol. IUPAC name: 2-methyl-5-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one. InChIKey: FEWBGEUMABLROF-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3O |
|---|---|
| Molecular weight | 217.15 g/mol |
| IUPAC name | 2-methyl-5-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | FEWBGEUMABLROF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CC(=O)N2N1)C(F)(F)F |
Computed by PubChem (NCBI)