Products 2803704-91-6
CAS 2803704-91-6 is the registry number for 3-Methoxy-5-(trifluoromethyl)imidazo[1,5-b]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methoxy-5-(trifluoromethyl)imidazo[1,5-b]pyridazine (CAS 2803704-91-6) is a chemical compound with the molecular formula C8H6F3N3O and a molecular weight of 217.15 g/mol. IUPAC name: 3-methoxy-5-(trifluoromethyl)imidazo[1,5-b]pyridazine. InChIKey: MJFRYZRFCXHXPF-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3O |
|---|---|
| Molecular weight | 217.15 g/mol |
| IUPAC name | 3-methoxy-5-(trifluoromethyl)imidazo[1,5-b]pyridazine |
| InChIKey | MJFRYZRFCXHXPF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(N=CN2N=C1)C(F)(F)F |
Computed by PubChem (NCBI)