CAS 1890955-29-9 is the registry number for 1,3,5-tris(benzyloxy)benzene, >95%, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4,6-difluoro-1-benzofuran-7-carbaldehyde (CAS 1890955-29-9) is a chemical compound with the molecular formula C9H4F2O2 and a molecular weight of 182.12 g/mol. IUPAC name: 4,6-difluoro-1-benzofuran-7-carbaldehyde. InChIKey: STHFEGDOWGQFAR-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O2 |
|---|---|
| Molecular weight | 182.12 g/mol |
| IUPAC name | 4,6-difluoro-1-benzofuran-7-carbaldehyde |
| InChIKey | STHFEGDOWGQFAR-UHFFFAOYSA-N |
| SMILES | C1=COC2=C1C(=CC(=C2C=O)F)F |
Computed by PubChem (NCBI)