CAS 1891-10-7 appears in our catalog under these names: 2,4-Dimethoxy-1-(2-nitrovinyl)benzene, 95%, 2,4-Dimethoxy-1-(2-nitrovinyl)benzene, 95+%, 2,4-Dimethoxy-beta-nitrostyrene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g.
2,4-dimethoxy-1-[(E)-2-nitroethenyl]benzene (CAS 1891-10-7) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2,4-dimethoxy-1-[(E)-2-nitroethenyl]benzene. InChIKey: NUMXHEUHHRTBQT-AATRIKPKSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 2,4-dimethoxy-1-[(E)-2-nitroethenyl]benzene |
| InChIKey | NUMXHEUHHRTBQT-AATRIKPKSA-N |
| SMILES | COC1=CC(=C(C=C1)/C=C/[N+](=O)[O-])OC |
Computed by PubChem (NCBI)