CAS 1891207-98-9 is the registry number for 8-Oxo-7H,8H-imidazo(1,2-a)pyrazine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
8-oxo-7H-imidazo[1,2-a]pyrazine-2-carboxylic acid (CAS 1891207-98-9) is a chemical compound with the molecular formula C7H5N3O3 and a molecular weight of 179.13 g/mol. IUPAC name: 8-oxo-7H-imidazo[1,2-a]pyrazine-2-carboxylic acid. InChIKey: QQMLZKFKSUKHPF-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O3 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 8-oxo-7H-imidazo[1,2-a]pyrazine-2-carboxylic acid |
| InChIKey | QQMLZKFKSUKHPF-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2C(=O)N1)C(=O)O |
Computed by PubChem (NCBI)