CAS 1891261-29-2 appears in our catalog under these names: 3-(3-Hydroxyphenyl)-2-thiophenecarboxylic acid, 97%, 3-(3-Hydroxyphenyl)-2-thiophenecarboxylic acid, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
3-(3-hydroxyphenyl)thiophene-2-carboxylic acid (CAS 1891261-29-2) is a chemical compound with the molecular formula C11H8O3S and a molecular weight of 220.25 g/mol. IUPAC name: 3-(3-hydroxyphenyl)thiophene-2-carboxylic acid. InChIKey: WTKBMDOBXNEHQB-UHFFFAOYSA-N.
| Molecular formula | C11H8O3S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 3-(3-hydroxyphenyl)thiophene-2-carboxylic acid |
| InChIKey | WTKBMDOBXNEHQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=C(SC=C2)C(=O)O |
Computed by PubChem (NCBI)