CAS 66386-16-1 is the registry number for 3-(1-Benzothiophen-3-yl)-2-oxopropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(1-benzothiophen-3-yl)-2-oxopropanoic acid (CAS 66386-16-1) is a chemical compound with the molecular formula C11H8O3S and a molecular weight of 220.25 g/mol. IUPAC name: 3-(1-benzothiophen-3-yl)-2-oxopropanoic acid. InChIKey: YAASHVCMTXVXDO-UHFFFAOYSA-N.
| Molecular formula | C11H8O3S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 3-(1-benzothiophen-3-yl)-2-oxopropanoic acid |
| InChIKey | YAASHVCMTXVXDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)CC(=O)C(=O)O |
Computed by PubChem (NCBI)