Products 1261896-15-4

CAS 1261896-15-4 is the registry number for 2-(2-Carboxythiophene-4-yl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-(2-hydroxyphenyl)thiophene-2-carboxylic acid (CAS 1261896-15-4) is a chemical compound with the molecular formula C11H8O3S and a molecular weight of 220.25 g/mol. IUPAC name: 4-(2-hydroxyphenyl)thiophene-2-carboxylic acid. InChIKey: NAEFBFBTJJDWFC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O3S
Molecular weight220.25 g/mol
IUPAC name4-(2-hydroxyphenyl)thiophene-2-carboxylic acid
InChIKeyNAEFBFBTJJDWFC-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CSC(=C2)C(=O)O)O

Computed by PubChem (NCBI)