CAS 1261896-15-4 is the registry number for 2-(2-Carboxythiophene-4-yl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-(2-hydroxyphenyl)thiophene-2-carboxylic acid (CAS 1261896-15-4) is a chemical compound with the molecular formula C11H8O3S and a molecular weight of 220.25 g/mol. IUPAC name: 4-(2-hydroxyphenyl)thiophene-2-carboxylic acid. InChIKey: NAEFBFBTJJDWFC-UHFFFAOYSA-N.
| Molecular formula | C11H8O3S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 4-(2-hydroxyphenyl)thiophene-2-carboxylic acid |
| InChIKey | NAEFBFBTJJDWFC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC(=C2)C(=O)O)O |
Computed by PubChem (NCBI)