CAS 116016-57-0 appears in our catalog under these names: 5-(4-hydroxyphenyl)thiophene-2-carboxylic acid, 5-(4-Hydroxyphenyl)thiophene-2-carboxylic acid, ≥95%, ≥95%, 5-(4-Hydroxyphenyl)thiophene-2-carboxylic acid, ≥95%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 750mg, 100mg, 250mg, 1g, 5g, 10g.
5-(4-hydroxyphenyl)thiophene-2-carboxylic acid (CAS 116016-57-0) is a chemical compound with the molecular formula C11H8O3S and a molecular weight of 220.25 g/mol. IUPAC name: 5-(4-hydroxyphenyl)thiophene-2-carboxylic acid. InChIKey: KUFHZPOQBMGGDB-UHFFFAOYSA-N.
| Molecular formula | C11H8O3S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 5-(4-hydroxyphenyl)thiophene-2-carboxylic acid |
| InChIKey | KUFHZPOQBMGGDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(S2)C(=O)O)O |
Computed by PubChem (NCBI)