Products 573722-47-1

CAS 573722-47-1 is the registry number for 2-Acetyl-1-benzothiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-acetyl-1-benzothiophene-3-carboxylic acid (CAS 573722-47-1) is a chemical compound with the molecular formula C11H8O3S and a molecular weight of 220.25 g/mol. IUPAC name: 2-acetyl-1-benzothiophene-3-carboxylic acid. InChIKey: HERIBGJXNKWRRX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O3S
Molecular weight220.25 g/mol
IUPAC name2-acetyl-1-benzothiophene-3-carboxylic acid
InChIKeyHERIBGJXNKWRRX-UHFFFAOYSA-N
SMILESCC(=O)C1=C(C2=CC=CC=C2S1)C(=O)O

Computed by PubChem (NCBI)