CAS 31914-17-7 is the registry number for 1,4-Naphthalenedione,2-hydroxy-3-(methylthio)-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
4-hydroxy-3-methylsulfanylnaphthalene-1,2-dione (CAS 31914-17-7) is a chemical compound with the molecular formula C11H8O3S and a molecular weight of 220.25 g/mol. IUPAC name: 4-hydroxy-3-methylsulfanylnaphthalene-1,2-dione. InChIKey: HNZUCGZAMRCFQH-UHFFFAOYSA-N.
| Molecular formula | C11H8O3S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 4-hydroxy-3-methylsulfanylnaphthalene-1,2-dione |
| InChIKey | HNZUCGZAMRCFQH-UHFFFAOYSA-N |
| SMILES | CSC1=C(C2=CC=CC=C2C(=O)C1=O)O |
Computed by PubChem (NCBI)