Products 1891846-88-0
CAS 1891846-88-0 is the registry number for Methyl 2-(3-chloro-2,4-difluorophenyl)-2-hydroxyacetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-(3-chloro-2,4-difluorophenyl)-2-hydroxyacetate (CAS 1891846-88-0) is a chemical compound with the molecular formula C9H7ClF2O3 and a molecular weight of 236.60 g/mol. IUPAC name: methyl 2-(3-chloro-2,4-difluorophenyl)-2-hydroxyacetate. InChIKey: FDLDJKDBVQBKKA-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O3 |
|---|---|
| Molecular weight | 236.60 g/mol |
| IUPAC name | methyl 2-(3-chloro-2,4-difluorophenyl)-2-hydroxyacetate |
| InChIKey | FDLDJKDBVQBKKA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C(=C(C=C1)F)Cl)F)O |
Computed by PubChem (NCBI)