CAS 18940-72-2 appears in our catalog under these names: Diethyl 4,5-thiazoledicarboxylate, 95%, Diethyl 4,5-Thiazoledicarboxylate, Diethyl 4,5–Thiazoledicarboxylate, Diethyl 4,5-Thiazoledicarboxylate 95%, Diethyl 4,5-Thiazoledicarboxylate, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 50mg.
Diethyl 1,3-thiazole-4,5-dicarboxylate (CAS 18940-72-2) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: diethyl 1,3-thiazole-4,5-dicarboxylate. InChIKey: RGPLYCBCMRYODB-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | diethyl 1,3-thiazole-4,5-dicarboxylate |
| InChIKey | RGPLYCBCMRYODB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC=N1)C(=O)OCC |
Computed by PubChem (NCBI)