Products 1896012-98-8
CAS 1896012-98-8 is the registry number for Methyl 1-(1,2,3,4-tetrahydroquinolin-6-yl)cyclopropane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-(1,2,3,4-tetrahydroquinolin-6-yl)cyclopropane-1-carboxylate (CAS 1896012-98-8) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: methyl 1-(1,2,3,4-tetrahydroquinolin-6-yl)cyclopropane-1-carboxylate. InChIKey: HNHKSFUXUVXIEP-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | methyl 1-(1,2,3,4-tetrahydroquinolin-6-yl)cyclopropane-1-carboxylate |
| InChIKey | HNHKSFUXUVXIEP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC1)C2=CC3=C(C=C2)NCCC3 |
Computed by PubChem (NCBI)