CAS 447-25-6 appears in our catalog under these names: rel-6-Deoxy-6-fluoroglucopyranose, 6-Deoxy-6-fluoro-D-galactose. Offered by: MedChemExpress, TRC, Biosynth. Available pack sizes: 10 mg, 10mg, 50mg, 25mg, 100mg.
(3R,4S,5S,6S)-6-(fluoromethyl)oxane-2,3,4,5-tetrol (CAS 447-25-6) is a chemical compound with the molecular formula C6H11FO5 and a molecular weight of 182.15 g/mol. IUPAC name: (3R,4S,5S,6S)-6-(fluoromethyl)oxane-2,3,4,5-tetrol. InChIKey: SHFYXYMHVMDNPY-GASJEMHNSA-N.
| Molecular formula | C6H11FO5 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | (3R,4S,5S,6S)-6-(fluoromethyl)oxane-2,3,4,5-tetrol |
| InChIKey | SHFYXYMHVMDNPY-GASJEMHNSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)F |
Computed by PubChem (NCBI)