CAS 189748-13-8 is the registry number for 5-(Furan-2-yl)indolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(furan-2-yl)-1,3-dihydroindol-2-one (CAS 189748-13-8) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 5-(furan-2-yl)-1,3-dihydroindol-2-one. InChIKey: AWOFOOPKKDKSFM-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 5-(furan-2-yl)-1,3-dihydroindol-2-one |
| InChIKey | AWOFOOPKKDKSFM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)C3=CC=CO3)NC1=O |
Computed by PubChem (NCBI)