CAS 1897627-95-0 is the registry number for 5-(4-Bromophenyl)pyrrolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(4-bromophenyl)pyrrolidine-2,4-dione (CAS 1897627-95-0) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 5-(4-bromophenyl)pyrrolidine-2,4-dione. InChIKey: XGZMFIIDPGKWKW-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 5-(4-bromophenyl)pyrrolidine-2,4-dione |
| InChIKey | XGZMFIIDPGKWKW-UHFFFAOYSA-N |
| SMILES | C1C(=O)C(NC1=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)